Introduction：Basic information about CAS 80717-52-8|Benzene,1,3,5-tribromo-2,4,6-triethyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene,1,3,5-tribromo-2,4,6-triethyl- |
|---|
| CAS Number | 80717-52-8 | Molecular Weight | 398.96000 |
|---|
| Density | 1.687g/cm3 | Boiling Point | 369.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15Br3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 172.3ºC |
|---|
Names
| Name | 1,3,5-tribromo-2,4,6-triethylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.687g/cm3 |
|---|
| Boiling Point | 369.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H15Br3 |
|---|
| Molecular Weight | 398.96000 |
|---|
| Flash Point | 172.3ºC |
|---|
| Exact Mass | 395.87200 |
|---|
| LogP | 5.66130 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | TTZNUTMDOHJHQM-UHFFFAOYSA-N |
|---|
| SMILES | CCc1c(Br)c(CC)c(Br)c(CC)c1Br |
|---|
Synonyms
| 1,3,5-Triethylhexahydro-s-triazine |
| 1,3,5-triethylhexahydrotriazine |
| 1,3,5-triethyl-1,3,5-triazacyclohexane |
| hexahydro-1,3,5-tris(2-ethyl)-s-triazine |
| Hexahydro-1,3,5-triethyl-s-triazine |
| 1,3,5-Triaethyl-2,4,6-tribrom-benzol |
| 1,3,5-triethyl-2,4,6-tribromo-benzene |
| 1,3,5-Triazine,1,3,5-triethylhexahydro |
| hexahydro-1,3,5-triethyl-1,3,5-triazine |
| 1,3,5-triethylhexahydro-1,3,5-triazine |
| Vancide-TH |
| s-Triazine,1,3,5-triethylhexahydro |
| Triethyl-trimethylenetriamine |
