Introduction：Basic information about CAS 15345-55-8|1H-Indole-2,3-dione,7-chloro-4-methoxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indole-2,3-dione,7-chloro-4-methoxy- |
|---|
| CAS Number | 15345-55-8 | Molecular Weight | 211.60200 |
|---|
| Density | 1.474g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C9H6ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 7-chloro-4-methoxy-1H-indole-2,3-dione |
|---|
Chemical & Physical Properties
| Density | 1.474g/cm3 |
|---|
| Molecular Formula | C9H6ClNO3 |
|---|
| Molecular Weight | 211.60200 |
|---|
| Exact Mass | 211.00400 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 1.62140 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | DVVWQQZWRTXTMK-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Cl)c2c1C(=O)C(=O)N2 |
|---|
