Introduction：Basic information about CAS 2090-08-6|4-methylbenzenesulfonic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methylbenzenesulfonic acid |
|---|
| CAS Number | 2090-08-6 | Molecular Weight | 309.52900 |
|---|
| Density | 1.34g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H8BaO3S++ | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | barium(2+),4-methylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.34g/cm3 |
|---|
| Molecular Formula | C7H8BaO3S++ |
|---|
| Molecular Weight | 309.52900 |
|---|
| Exact Mass | 309.92500 |
|---|
| PSA | 62.75000 |
|---|
| LogP | 2.32250 |
|---|
| InChIKey | JTRGEBZVNIQMHI-UHFFFAOYSA-L |
|---|
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1.[Ba+2] |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 20/22 |
|---|
| Safety Phrases | 28 |
|---|
| HS Code | 2904100000 |
|---|
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| EINECS 218-237-5 |
| p-toluenesulfonic acid,barium salt |
| Ba-Salz von p-Toluolsulfonsaeure |
| Toluol-4-sulfonsaeure,Barium-Verbindung |
| barium p-toluenesulfonate |
| toluene-4-sulfonic acid,barium compound |
