Introduction:Basic information about CAS 148857-42-5|(S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione |
|---|
| CAS Number | 148857-42-5 | Molecular Weight | 239.655 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 405.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.0±25.9 °C |
|---|
Names
| Name | 2-[(2S)-3-Chloro-2-hydroxypropyl]-1H-isoindole-1,3(2H)-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 405.4±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO3 |
|---|
| Molecular Weight | 239.655 |
|---|
| Flash Point | 199.0±25.9 °C |
|---|
| Exact Mass | 239.034927 |
|---|
| PSA | 57.61000 |
|---|
| LogP | 1.63 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | KBRVYEPWGIQEOF-SSDOTTSWSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)CCl |
|---|
Safety Information
Synonyms
| 3-chloro-1-phenylmethylamino-2-hydroxypropane |
| N-(3-chloro-2-hydroxypropyl)phthalimide |
| (-)-2-(3-chloro-2-hydroxypropyl)-1H-isoindole-1,3(2H)-dione |
| 1-(N-benzyl)amino-3-chloro-2-propanol |
| (RS)-1-chloro-3-phthalimidopropan-2-ol |
| 1-(benzylamino)-3-chloro-2-propanol |
| 1-chloro-3-benzylpropan-2-ol |
| 2-Propanol,1-chloro-3-[(phenylmethyl)amino] |
| (+/-)-1-chloro-3-phthalimido-2-propanol |
| (S)-1-phthalimido-3-chloro-2-propanol |
| 1H-Isoindole-1,3(2H)-dione, 2-[(2S)-3-chloro-2-hydroxypropyl]- |
| 2-[(2S)-3-Chloro-2-hydroxypropyl]-1H-isoindole-1,3(2H)-dione |
| rac-1-phthalimido-3-chloro-2-propanol |
| N-(3-chloro-2-hydroxypropyl)benzylamine |
| 1-(benzylamino)-3-chloropropan-2-ol |
| N-benzyl-3-chloro-2-hydroxypropylamine |
| 3-(Benzylamino)-1-chloro-2-propanol |
| (S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione |
| Rivaroxaban Impurity 53 |