Introduction：Basic information about CAS 75628-94-3|Methyl 7-(benzyloxy)-4,6-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 7-(benzyloxy)-4,6-dimethoxy-2-naphthoate |
|---|
| CAS Number | 75628-94-3 | Molecular Weight | 352.38100 |
|---|
| Density | 1.197g/cm3 | Boiling Point | 505.8ºC at 760 mmHg |
|---|
| Molecular Formula | C21H20O5 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 221.8ºC |
|---|
Names
| Name | Methyl 7-(benzyloxy)-4,6-dimethoxy-2-naphthoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.197g/cm3 |
|---|
| Boiling Point | 505.8ºC at 760 mmHg |
|---|
| Molecular Formula | C21H20O5 |
|---|
| Molecular Weight | 352.38100 |
|---|
| Flash Point | 221.8ºC |
|---|
| Exact Mass | 352.13100 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 4.22260 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | ULMNSBWOXTVFLL-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2cc(OC)c(OCc3ccccc3)cc2c1 |
|---|
Synonyms
| methyl 6-benzyloxy-1,7-dimethoxy-3-naphthoate |
| 7-benzyloxy-trifluoromethyl coumarin |
| 7-Benzyloxy-4-trifluoromethylcoumarin |
