Introduction：Basic information about CAS 90577-16-5|Methyl 7-bromo-5-hydroxy-4,8-dimethoxy-6-methyl-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 7-bromo-5-hydroxy-4,8-dimethoxy-6-methyl-2-naphthoate |
|---|
| CAS Number | 90577-16-5 | Molecular Weight | 355.18100 |
|---|
| Density | 1.477g/cm3 | Boiling Point | 498.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15BrO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 255.3ºC |
|---|
Names
| Name | Methyl 7-bromo-5-hydroxy-4,8-dimethoxy-6-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.477g/cm3 |
|---|
| Boiling Point | 498.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15BrO5 |
|---|
| Molecular Weight | 355.18100 |
|---|
| Flash Point | 255.3ºC |
|---|
| Exact Mass | 354.01000 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 3.42010 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | ITEANEQRTYTSMC-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC)c2c(O)c(C)c(Br)c(OC)c2c1 |
|---|
