Introduction：Basic information about CAS 91805-62-8|4-(2-Bromoacetoxy)-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-Bromoacetoxy)-2-naphthoic acid |
|---|
| CAS Number | 91805-62-8 | Molecular Weight | 309.11200 |
|---|
| Density | 1.653g/cm3 | Boiling Point | 466.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9BrO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.7ºC |
|---|
Names
| Name | 4-(2-Bromoacetoxy)-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.653g/cm3 |
|---|
| Boiling Point | 466.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H9BrO4 |
|---|
| Molecular Weight | 309.11200 |
|---|
| Flash Point | 235.7ºC |
|---|
| Exact Mass | 307.96800 |
|---|
| PSA | 63.60000 |
|---|
| LogP | 2.83830 |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | LFZKPXWWDNWBGW-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)Oc1cc(C(=O)O)cc2ccccc12 |
|---|
