Introduction:Basic information about CAS 115061-33-1|Methyl 4,6-diacetoxy-5,7-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4,6-diacetoxy-5,7-dimethoxy-2-naphthoate |
|---|
| CAS Number | 115061-33-1 | Molecular Weight | 362.33100 |
|---|
| Density | / | Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 207.9ºC |
|---|
Names
| Name | Methyl 4,6-diacetoxy-5,7-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C18H18O8 |
|---|
| Molecular Weight | 362.33100 |
|---|
| Flash Point | 207.9ºC |
|---|
| Exact Mass | 362.10000 |
|---|
| PSA | 97.36000 |
|---|
| LogP | 2.49420 |
|---|
| Vapour Pressure | 3.73E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.558 |
|---|
| InChIKey | XARNCHKTMFKKNM-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2c(OC)c(OC(C)=O)c(OC)cc2c1 |
|---|