Introduction:Basic information about CAS 120016-57-1|Methyl 4,8-dihydroxy-5-methoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4,8-dihydroxy-5-methoxy-2-naphthoate |
|---|
| CAS Number | 120016-57-1 | Molecular Weight | 248.23100 |
|---|
| Density | 1.361g/cm3 | Boiling Point | 495.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.9ºC |
|---|
Names
| Name | Methyl 4,8-dihydroxy-5-methoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.361g/cm3 |
|---|
| Boiling Point | 495.8ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O5 |
|---|
| Molecular Weight | 248.23100 |
|---|
| Flash Point | 194.9ºC |
|---|
| Exact Mass | 248.06800 |
|---|
| PSA | 75.99000 |
|---|
| LogP | 2.04620 |
|---|
| Vapour Pressure | 1.87E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.647 |
|---|
| InChIKey | ZJSQEZDZRAKLFM-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2c(OC)ccc(O)c2c1 |
|---|