Introduction:Basic information about CAS 124895-57-4|6,7-Bis(benzyloxy)-4-hydroxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6,7-Bis(benzyloxy)-4-hydroxy-2-naphthoic acid |
|---|
| CAS Number | 124895-57-4 | Molecular Weight | 400.42300 |
|---|
| Density | / | Boiling Point | 626.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H20O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.4ºC |
|---|
Names
| Name | 6,7-Bis(benzyloxy)-4-hydroxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Boiling Point | 626.7ºC at 760 mmHg |
|---|
| Molecular Formula | C25H20O5 |
|---|
| Molecular Weight | 400.42300 |
|---|
| Flash Point | 218.4ºC |
|---|
| Exact Mass | 400.13100 |
|---|
| PSA | 75.99000 |
|---|
| LogP | 5.40160 |
|---|
| Vapour Pressure | 1.43E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | MWZREUYINUHJJQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(O)c2cc(OCc3ccccc3)c(OCc3ccccc3)cc2c1 |
|---|