Introduction:Basic information about CAS 127266-01-7|2-Naphthalenecarboxylic acid, 4-hydroxy-6-Methyl-, Methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Naphthalenecarboxylic acid, 4-hydroxy-6-Methyl-, Methyl ester |
|---|
| CAS Number | 127266-01-7 | Molecular Weight | 216.23300 |
|---|
| Density | 1.227g/cm3 | Boiling Point | 401.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl 4-hydroxy-6-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.227g/cm3 |
|---|
| Boiling Point | 401.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12O3 |
|---|
| Molecular Weight | 216.23300 |
|---|
| Exact Mass | 216.07900 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.64040 |
|---|
| Vapour Pressure | 4.99E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | UKKWQEPTBOQNCO-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2cc(C)ccc2c1 |
|---|