Introduction:Basic information about CAS 127266-03-9|Methyl 4-hydroxy-6,7-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-hydroxy-6,7-dimethoxy-2-naphthoate |
|---|
| CAS Number | 127266-03-9 | Molecular Weight | 262.25800 |
|---|
| Density | 1.261g/cm3 | Boiling Point | 444.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.4ºC |
|---|
Names
| Name | Methyl 4-hydroxy-6,7-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Boiling Point | 444.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O5 |
|---|
| Molecular Weight | 262.25800 |
|---|
| Flash Point | 169.4ºC |
|---|
| Exact Mass | 262.08400 |
|---|
| PSA | 64.99000 |
|---|
| LogP | 2.34920 |
|---|
| Vapour Pressure | 1.57E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | JTOIQIURFBFTNG-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(O)c2cc(OC)c(OC)cc2c1 |
|---|