Introduction：Basic information about CAS 144003-45-2|Methyl 4-acetoxy-8-(benzyloxy)-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-acetoxy-8-(benzyloxy)-2-naphthoate |
|---|
| CAS Number | 144003-45-2 | Molecular Weight | 350.36500 |
|---|
| Density | 1.235g/cm3 | Boiling Point | 523.208ºC at 760 mmHg |
|---|
| Molecular Formula | C21H18O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 230.072ºC |
|---|
Names
| Name | Methyl 4-acetoxy-8-(benzyloxy)-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.235g/cm3 |
|---|
| Boiling Point | 523.208ºC at 760 mmHg |
|---|
| Molecular Formula | C21H18O5 |
|---|
| Molecular Weight | 350.36500 |
|---|
| Flash Point | 230.072ºC |
|---|
| Exact Mass | 350.11500 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 4.13070 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | FZCWGCLZDTZAPM-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(OC(C)=O)c2cccc(OCc3ccccc3)c2c1 |
|---|
