Introduction：Basic information about CAS 152039-03-7|Ethyl 4-acetoxy-7-chloro-5,8-dimethoxy-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-7-chloro-5,8-dimethoxy-2-naphthoate |
|---|
| CAS Number | 152039-03-7 | Molecular Weight | 352.76600 |
|---|
| Density | / | Boiling Point | 501.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17ClO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-7-chloro-5,8-dimethoxy-2-naphthoate |
|---|
Chemical & Physical Properties
| Boiling Point | 501.2ºC at 760 mmHg |
|---|
| Molecular Formula | C17H17ClO6 |
|---|
| Molecular Weight | 352.76600 |
|---|
| Flash Point | 192ºC |
|---|
| Exact Mass | 352.07100 |
|---|
| PSA | 71.06000 |
|---|
| LogP | 3.61240 |
|---|
| Vapour Pressure | 3.54E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | VSXVWPULDHSECL-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c(OC)cc(Cl)c(OC)c2c1 |
|---|
