Introduction:Basic information about CAS 218961-13-8|Ethyl 4-hydroxy-6-(methylsulfanyl)-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-hydroxy-6-(methylsulfanyl)-2-naphthoate |
|---|
| CAS Number | 218961-13-8 | Molecular Weight | 262.32400 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 464.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234.9ºC |
|---|
Names
| Name | Ethyl 4-hydroxy-6-(methylsulfanyl)-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 464.9ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14O3S |
|---|
| Molecular Weight | 262.32400 |
|---|
| Flash Point | 234.9ºC |
|---|
| Exact Mass | 262.06600 |
|---|
| PSA | 71.83000 |
|---|
| LogP | 3.44400 |
|---|
| Vapour Pressure | 2.9E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.649 |
|---|
| InChIKey | XMLQTSNTIPLNNK-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(O)c2cc(SC)ccc2c1 |
|---|