Introduction:Basic information about CAS 876483-85-1|4,6-Dihydroxy-2-naphthoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,6-Dihydroxy-2-naphthoic acid |
|---|
| CAS Number | 876483-85-1 | Molecular Weight | 204.17900 |
|---|
| Density | 1.535g/cm3 | Boiling Point | 490.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.3ºC |
|---|
Names
| Name | 4,6-Dihydroxy-2-naphthoic acid |
|---|
Chemical & Physical Properties
| Density | 1.535g/cm3 |
|---|
| Boiling Point | 490.1ºC at 760 mmHg |
|---|
| Molecular Formula | C11H8O4 |
|---|
| Molecular Weight | 204.17900 |
|---|
| Flash Point | 264.3ºC |
|---|
| Exact Mass | 204.04200 |
|---|
| PSA | 77.76000 |
|---|
| LogP | 1.94920 |
|---|
| Index of Refraction | 1.761 |
|---|
| InChIKey | MRWBETSQITXMKQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(O)c2cc(O)ccc2c1 |
|---|