Introduction:Basic information about CAS 1261910-15-9|2'-METHYL-[1,1'-BIPHENYL]-3,4'-DICARBOXYLIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2'-METHYL-[1,1'-BIPHENYL]-3,4'-DICARBOXYLIC ACID |
|---|
| CAS Number | 1261910-15-9 | Molecular Weight | 256.25300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(3-carboxyphenyl)-3-methylbenzoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H12O4 |
|---|
| Molecular Weight | 256.25300 |
|---|
| Exact Mass | 256.07400 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 3.05840 |
|---|
| InChIKey | CXYZKFMQBLJPQG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)O)ccc1-c1cccc(C(=O)O)c1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|