Introduction:Basic information about CAS 54389-67-2|4,4'-Dibromo-2,2'-biphenyldicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Dibromo-2,2'-biphenyldicarboxylic acid |
|---|
| CAS Number | 54389-67-2 | Molecular Weight | 400.019 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 497.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8Br2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.9±28.7 °C |
|---|
Names
| Name | 4,4'-Dibromodiphenic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 497.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H8Br2O4 |
|---|
| Molecular Weight | 400.019 |
|---|
| Flash Point | 254.9±28.7 °C |
|---|
| Exact Mass | 397.878906 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 3.91 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | SIRUSURTIAQXGZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Br)ccc1-c1ccc(Br)cc1C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| [1,1'-Biphenyl]-2,2'-dicarboxylic acid, 4,4'-dibromo- |
| 4,4'-Dibromo-2,2'-biphenyldicarboxylic acid |
| 4,4'-dibromo-2,2'-dicarboxy-1,1'-biphenyl |
| 4,4'-Dibromobiphenyl-2,2'-dicarboxylic acid |
| 4.4'-Dibrom-diphenyl-dicarbonsaeure-(2.2') |
| 4,4'-Dibromdiphensaeure |
| 4,4'-Dibromodiphenicacid |