Introduction：Basic information about CAS 80573-03-1|Ipsalazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ipsalazide |
|---|
| CAS Number | 80573-03-1 | Molecular Weight | 343.29100 |
|---|
| Density | 1.486g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C16H13N3O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3E)-3-[[4-(carboxymethylcarbamoyl)phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.486g/cm3 |
|---|
| Molecular Formula | C16H13N3O6 |
|---|
| Molecular Weight | 343.29100 |
|---|
| Exact Mass | 343.08000 |
|---|
| PSA | 148.65000 |
|---|
| LogP | 2.71110 |
|---|
| Index of Refraction | 1.662 |
|---|
| InChIKey | CQSRTOJJBONKMC-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)CNC(=O)c1ccc(N=Nc2ccc(O)c(C(=O)O)c2)cc1 |
|---|
Synonyms
| Ipsalazido |
| Ipsalazide |
| Ipsalazida |
| (E)-p-((3-Carboxy-4-hydroxyphenyl)azo)hippuric acid |
| BX-650A |
| (E)-5-((4-(((Carboxymethyl)amino)carbonyl)phenyl)azo)-2-hydroxybenzoic acid |
| Ipsalazidum [Latin] |
| Ipsalazida [Spanish] |
| Ipsalazido [Spanish] |
| Benzoic acid,5-((4-(((carboxymethyl)amino)carbonyl)phenyl)azo)-2-hydroxy-,(E) |
