Introduction:Basic information about CAS 57010-31-8|N-[2-(3,4-Dimethoxyphenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)-1,1,3 ,3-tetraoxid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-(3,4-Dimethoxyphenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)-1,1,3 ,3-tetraoxido-1,3-dithian-2-yl]-N-methyl-1-propanamine |
|---|
| CAS Number | 57010-31-8 | Molecular Weight | 555.70400 |
|---|
| Density | 1.235g/cm3 | Boiling Point | 750.9ºC at 760mmHg |
|---|
| Molecular Formula | C26H37NO8S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 407.9ºC |
|---|
Names
| Name | N-[2-(3,4-Dimethoxyphenyl)ethyl]-3-[2-(3,4-dimethoxyphenyl)-1,1,3 ,3-tetraoxido-1,3-dithian-2-yl]-N-methyl-1-propanamine |
|---|
Chemical & Physical Properties
| Density | 1.235g/cm3 |
|---|
| Boiling Point | 750.9ºC at 760mmHg |
|---|
| Molecular Formula | C26H37NO8S2 |
|---|
| Molecular Weight | 555.70400 |
|---|
| Flash Point | 407.9ºC |
|---|
| Exact Mass | 555.19600 |
|---|
| PSA | 125.20000 |
|---|
| LogP | 5.22340 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | ZROUQTNYPCANTN-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(CCN(C)CCCC2(c3ccc(OC)c(OC)c3)S(=O)(=O)CCCS2(=O)=O)cc1OC |
|---|