Introduction：Basic information about CAS 197142-34-0|N-Boc-L-trans-4,5-methanoproline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Boc-L-trans-4,5-methanoproline |
|---|
| CAS Number | 197142-34-0 | Molecular Weight | 227.257 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.9±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.0±23.2 °C |
|---|
Names
| Name | (1R,3S,5R)-2-[(2-methylpropan-2-yl)oxycarbonyl]-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 355.9±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H17NO4 |
|---|
| Molecular Weight | 227.257 |
|---|
| Flash Point | 169.0±23.2 °C |
|---|
| Exact Mass | 227.115753 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 0.41 |
|---|
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.537 |
|---|
| InChIKey | VXIIZQXOIDYWBS-PRJMDXOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1C(C(=O)O)CC2CC21 |
|---|
Synonyms
| (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| N-Boc-L-trans-4,5-methanoproline |
| (1R,3S,5R)-2-(tert-butoxycarbonyl)-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| (1R,3S,5R)-2-aza-bicyclo[3.1.0]hexane-2,3-dicarboxylic acid 2-tert-butyl ester |
| 2-Azabicyclo[3.1.0]hexane-2,3-dicarboxylic acid, 2-(1,1-dimethylethyl) ester, (1R,3S,5R)- |
| (1R,3S,5R)-2-tert-butoxycarbonyl-2-azabicyclo[3.1.0]hexane-3-carboxylic acid |
| (4R,5R)-metano-N-Boc-L-proline |
