Introduction:Basic information about CAS 75476-80-1|1H-Indene,6-nitro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Indene,6-nitro- |
|---|
| CAS Number | 75476-80-1 | Molecular Weight | 161.15700 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 283.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.9ºC |
|---|
Names
| Name | 6-nitro-1H-indene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 283.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H7NO2 |
|---|
| Molecular Weight | 161.15700 |
|---|
| Flash Point | 136.9ºC |
|---|
| Exact Mass | 161.04800 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.68730 |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | UJHGOFSFBKXJNM-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc2c(c1)CC=C2 |
|---|
Synonyms
| 6-nitroind-1-ene |
| 6-Nitroindene |
| Indene,6-nitro |
| 1H-Indene,6-nitro |