Introduction：Basic information about CAS 53014-37-2|tetranitroaniline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetranitroaniline |
|---|
| CAS Number | 53014-37-2 | Molecular Weight | 273.11700 |
|---|
| Density | 1.963g/cm3 | Boiling Point | 569.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H3N5O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 298.2ºC |
|---|
Names
| Name | 2,3,5,6-tetranitroaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.963g/cm3 |
|---|
| Boiling Point | 569.5ºC at 760mmHg |
|---|
| Molecular Formula | C6H3N5O8 |
|---|
| Molecular Weight | 273.11700 |
|---|
| Flash Point | 298.2ºC |
|---|
| Exact Mass | 272.99800 |
|---|
| PSA | 209.30000 |
|---|
| LogP | 3.57560 |
|---|
| Index of Refraction | 1.75 |
|---|
| InChIKey | NXEMFHROMKRKEG-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c([N+](=O)[O-])c([N+](=O)[O-])cc([N+](=O)[O-])c1[N+](=O)[O-] |
|---|
Synonyms
| EINECS 258-295-9 |
| Benzenamine,tetranitro |
| UN0207 |
| Tetranitroaniline [UN0207] [Explosive 1.1D] |
