Introduction:Basic information about CAS 129011-98-9|5(6)-carbethoxy-2-(4'-hydroxyphenyl)-benzimidazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5(6)-carbethoxy-2-(4'-hydroxyphenyl)-benzimidazole |
|---|
| CAS Number | 129011-98-9 | Molecular Weight | 282.29400 |
|---|
| Density | 1.324g/cm3 | Boiling Point | 521.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 269ºC |
|---|
Names
| Name | 5(6)-carbethoxy-2-(4'-hydroxyphenyl)-benzimidazole |
|---|
Chemical & Physical Properties
| Density | 1.324g/cm3 |
|---|
| Boiling Point | 521.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H14N2O3 |
|---|
| Molecular Weight | 282.29400 |
|---|
| Flash Point | 269ºC |
|---|
| Exact Mass | 282.10000 |
|---|
| PSA | 75.21000 |
|---|
| LogP | 3.11220 |
|---|
| Vapour Pressure | 1.77E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.668 |
|---|
| InChIKey | ZPCQLMOLGCRQPN-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc2nc(-c3ccc(O)cc3)[nH]c2c1 |
|---|