Introduction：Basic information about CAS 42530-35-8|6'-[ethyl(p-tolyl)amino]-2'-(methylphenylamino)spiro[isobenzofuran-1(3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6'-[ethyl(p-tolyl)amino]-2'-(methylphenylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
|---|
| CAS Number | 42530-35-8 | Molecular Weight | 538.63500 |
|---|
| Density | 1.32 g/cm3 | Boiling Point | 763.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H30N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 415.4ºC |
|---|
Names
| Name | 6'-[ethyl(p-tolyl)amino]-2'-(methylphenylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
|---|
Chemical & Physical Properties
| Density | 1.32 g/cm3 |
|---|
| Boiling Point | 763.3ºC at 760 mmHg |
|---|
| Molecular Formula | C36H30N2O3 |
|---|
| Molecular Weight | 538.63500 |
|---|
| Flash Point | 415.4ºC |
|---|
| Exact Mass | 538.22600 |
|---|
| PSA | 42.01000 |
|---|
| LogP | 8.48890 |
|---|
| Index of Refraction | 1.72 |
|---|
| InChIKey | PALATEZPVSTFIX-UHFFFAOYSA-N |
|---|
| SMILES | CCN(c1ccc(C)cc1)c1ccc2c(c1)Oc1ccc(N(C)c3ccccc3)cc1C21OC(=O)c2ccccc21 |
|---|
