Introduction:Basic information about CAS 51084-27-6|2-chloro-4-sulfobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-4-sulfobenzoic acid |
|---|
| CAS Number | 51084-27-6 | Molecular Weight | 236.63000 |
|---|
| Density | 1.731g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C7H5ClO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-chloro-4-sulfobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.731g/cm3 |
|---|
| Molecular Formula | C7H5ClO5S |
|---|
| Molecular Weight | 236.63000 |
|---|
| Exact Mass | 235.95500 |
|---|
| PSA | 100.05000 |
|---|
| LogP | 2.36570 |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | ZTRKCBFXSUUQGS-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Chloro-4-sulfobenzoicacid |
| 2-Chloro-4-sulphobenzoic acid |
| 4-sulfo-2-chlorobenzoic acid |
| 2-Chlor-4-sulfo-benzoesaeure |
| Benzoic acid,2-chloro-4-sulfo |
| 3-chloro-4-carboxybenzenesulfonic acid |
| EINECS 256-957-1 |
| 2-Chlor-benzoesaeure-sulfonsaeure-(4) |