Introduction：Basic information about CAS 86386-76-7|1-{[2-(2,4-DIFLUOROPHENYL)OXIRAN-2-YL]METHYL}-1H-1,2,4-TRIAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-{[2-(2,4-DIFLUOROPHENYL)OXIRAN-2-YL]METHYL}-1H-1,2,4-TRIAZOLE |
|---|
| CAS Number | 86386-76-7 | Molecular Weight | 237.20500 |
|---|
| Density | 1.464g/cm3 | Boiling Point | 370.474ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9F2N3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.857ºC |
|---|
Names
| Name | 1-[2-(2,4-difluorophenyl)-2,3-epoxypropyl]-1h-1,2,4-triazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.464g/cm3 |
|---|
| Boiling Point | 370.474ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9F2N3O |
|---|
| Molecular Weight | 237.20500 |
|---|
| Flash Point | 177.857ºC |
|---|
| Exact Mass | 237.07100 |
|---|
| PSA | 43.24000 |
|---|
| LogP | 1.48200 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | UIXQTZYZQHYHRL-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc(C2(Cn3cncn3)CO2)c(F)c1 |
|---|
Synonyms
| 2-(2,4-Difluorophenyl)-2,3-epoxy-1-(1H-1,2,4-triazol-1-yl)propane |
| Fluconazole Epoxy IMpurity |
| 2-[(1H-1,2,4-triazol-1-yl)methyl]-2-(2,4-difluorophenyl)oxirane |
| 1-(2-(2,4-difluorophenyl)oxiran-2-yl)methyl-1H-1,2,4-triazole |
| l-[2-(2,4-Difluoro Phenyl)Oxiranyl] Methyl-lH-1,2,4-Triazole |
| 1-[[2-(2,4-difluorophenyl)oxiranyl]methyl]-1H-1,2,4-triazole |
| 2-(2,4-Difluorophenyl)-2-[(1H-1,2,4-triazol-1-yl)Methyl]oxirane |
| 1,2-epoxy-2-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)-propane |
