Introduction:Basic information about CAS 121845-55-4|3-(4-fluorophenyl)pyrido[3,4-e][1,2,4]triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-fluorophenyl)pyrido[3,4-e][1,2,4]triazine |
|---|
| CAS Number | 121845-55-4 | Molecular Weight | 226.20900 |
|---|
| Density | 1.363g/cm3 | Boiling Point | 426.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H7FN4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.6ºC |
|---|
Names
| Name | 3-(4-fluorophenyl)pyrido[3,4-e][1,2,4]triazine |
|---|
Chemical & Physical Properties
| Density | 1.363g/cm3 |
|---|
| Boiling Point | 426.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H7FN4 |
|---|
| Molecular Weight | 226.20900 |
|---|
| Flash Point | 211.6ºC |
|---|
| Exact Mass | 226.06500 |
|---|
| PSA | 51.56000 |
|---|
| LogP | 2.22590 |
|---|
| Vapour Pressure | 4.48E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | MTOKXMIUBZRWQT-UHFFFAOYSA-N |
|---|
| SMILES | Fc1ccc(-c2nnc3ccncc3n2)cc1 |
|---|