Introduction:Basic information about CAS 144550-36-7|Iodosulfuron methyl sodium, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Iodosulfuron methyl sodium |
|---|
| CAS Number | 144550-36-7 | Molecular Weight | 529.24200 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H13IN5NaO6S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS09 | Signal Word | Warning |
|---|
Names
| Name | iodosulfuron-methyl-sodium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H13IN5NaO6S |
|---|
| Molecular Weight | 529.24200 |
|---|
| Exact Mass | 528.95300 |
|---|
| PSA | 149.06000 |
|---|
| LogP | 2.42070 |
|---|
| InChIKey | JUJFQMPKBJPSFZ-UHFFFAOYSA-M |
|---|
| SMILES | COC(=O)c1ccc(I)cc1S(=O)(=O)[N-]C(=O)Nc1nc(C)nc(OC)n1.[Na+] |
|---|
| Storage condition | 0-6°C |
|---|
Safety Information
| Symbol | GHS09 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H410 |
|---|
| Precautionary Statements | P273-P501 |
|---|
| Personal Protective Equipment | Eyeshields;Gloves |
|---|
| Hazard Codes | N:Dangerousfortheenvironment; |
|---|
| Risk Phrases | R50/53 |
|---|
| Safety Phrases | S60-S61 |
|---|
| RIDADR | UN 3077 |
|---|
Synonyms
| sodium {[5-iodo-2-(methoxycarbonyl)benzenesulfonyl]carbamoyl}(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide |
| Methyl 4-iodo-2-[3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)ureidosulfonyl]benzoate sodium salt |
| sodium ({[5-iodo-2-(methoxycarbonyl)phenyl]sulfonyl}carbamoyl)(4-methoxy-6-methyl-1,3,5-triazin-2-yl)azanide |
| iodosulfuron-methyl |
| Iodosulfuron-methyl-sodium |
| sodium salt of methyl 4-iodo-2-[[[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]amino]sulfonyl]benzoate |
| MFCD06636642 |