Introduction：Basic information about CAS 356-36-5|dimethyl tetrafluorosuccinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimethyl tetrafluorosuccinate |
|---|
| CAS Number | 356-36-5 | Molecular Weight | 218.10300 |
|---|
| Density | 1,463 g/cm3 | Boiling Point | 177-178°C |
|---|
| Molecular Formula | C6H6F4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 72.1ºC |
|---|
Names
| Name | dimethyl 2,2,3,3-tetrafluorobutanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,463 g/cm3 |
|---|
| Boiling Point | 177-178°C |
|---|
| Molecular Formula | C6H6F4O4 |
|---|
| Molecular Weight | 218.10300 |
|---|
| Flash Point | 72.1ºC |
|---|
| Exact Mass | 218.02000 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 0.60300 |
|---|
| Index of Refraction | 1.353 |
|---|
| InChIKey | RMXAYQBUNVSEPG-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(F)(F)C(F)(F)C(=O)OC |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2917190090 |
|---|
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| DiMethyl Tetrafluorosuccinate |
| Dimethyl-tetrafluorsuccinat |
| dimethyltetrafluorosuccinate |
| MFCD00043947 |
| Dimethyl Perfluorosuccinate |
| Tetrafluor-bernsteinsaeure-dimethylester |
| Dimethyl Tetrafluorobutanedioate |
| tetrafluorosuccinic acid dimethyl ester |
| Tetrafluorobutanedioic Acid Dimethyl Ester |
