Introduction：Basic information about CAS 118-76-3|5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetraone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetraone |
|---|
| CAS Number | 118-76-3 | Molecular Weight | 170.07600 |
|---|
| Density | 2.246g/cm3 | Boiling Point | 346.7ºC at 760mmHg |
|---|
| Molecular Formula | C6H2O6 | Melting Point | 255-257ºC |
|---|
| MSDS | / | Flash Point | 177.7ºC |
|---|
Names
| Name | rhodizonic acid dihydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.246g/cm3 |
|---|
| Boiling Point | 346.7ºC at 760mmHg |
|---|
| Melting Point | 255-257ºC |
|---|
| Molecular Formula | C6H2O6 |
|---|
| Molecular Weight | 170.07600 |
|---|
| Flash Point | 177.7ºC |
|---|
| Exact Mass | 169.98500 |
|---|
| PSA | 108.74000 |
|---|
| Vapour Pressure | 3.5E-06mmHg at 25°C |
|---|
| InChIKey | WCJLIWFWHPOTAC-UHFFFAOYSA-N |
|---|
| SMILES | O=c1c(O)c(O)c(=O)c(=O)c1=O |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2914400090 |
|---|
Customs
| HS Code | 2914400090 |
|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| DIHYDROXYDIQUINOYL |
| 1,2-Dihydroxy-3,4,5,6-tetraoxocyclohexene |
| Einecs 204-276-5 |
| 5,6-dihydroxy-5-cyclohexen-1,2,3,4-tetraone |
| 5,6-dihydroxycyclohex-5-ene-1,2,3,4-tetraone |
| rhodizonicacid |
| Dihydroxy-cyclohexentetraon |
| 5,6-Dihydroxy-1,2,3,4-benzodiquinone |
| MFCD00149072 |
| 5,6-dihydroxy-5-cyclohexene-1,2,3,4-tetrone |
| 5,6-dihydroxy-5-cyclohexene-1,2,3,4-tetraone |
| 5,6-Dihydroxy-cyclohex-5-en-1,2,3,4-tetraon |
