Introduction：Basic information about CAS 519-05-1|5,6-Dimethoxyphthalaldehydic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-Dimethoxyphthalaldehydic acid |
|---|
| CAS Number | 519-05-1 | Molecular Weight | 210.18300 |
|---|
| Density | 1.3 g/cm3 | Boiling Point | 386.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10O5 | Melting Point | 145-148°C |
|---|
| MSDS | / | Flash Point | 155.1ºC |
|---|
Names
| Name | 6-Formyl-2,3-dimethoxybenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3 g/cm3 |
|---|
| Boiling Point | 386.3ºC at 760 mmHg |
|---|
| Melting Point | 145-148°C |
|---|
| Molecular Formula | C10H10O5 |
|---|
| Molecular Weight | 210.18300 |
|---|
| Flash Point | 155.1ºC |
|---|
| Exact Mass | 210.05300 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 1.21450 |
|---|
| Index of Refraction | 1.573 |
|---|
| InChIKey | HVXXOIGTXJOVON-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C=O)c(C(=O)O)c1OC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Opianic acid |
| o-Veratric acid,6-formyl |
| EINECS 208-261-4 |
| MFCD00039572 |
| 2-carboxy-3,4-dimethoxybenzaldehyde |
| 5,6-dimethoxy-2-formylbenzoic acid |
| 6-formyl-2,3-dimethoxy-benzoic acid |
| 5,6-Dimethoxyphthalaldehydic acid |
| 2-formyl-5,6-dimethoxybenzoic acid |
