Introduction：Basic information about CAS 915920-86-4|3-(1,2,4-triazol-1-yl)adamantan-1-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(1,2,4-triazol-1-yl)adamantan-1-amine |
|---|
| CAS Number | 915920-86-4 | Molecular Weight | 218.29800 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 370.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H18N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178ºC |
|---|
Names
| Name | 3-(1,2,4-triazol-1-yl)adamantan-1-amine |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 370.8ºC at 760 mmHg |
|---|
| Molecular Formula | C12H18N4 |
|---|
| Molecular Weight | 218.29800 |
|---|
| Flash Point | 178ºC |
|---|
| Exact Mass | 218.15300 |
|---|
| PSA | 56.73000 |
|---|
| LogP | 1.98500 |
|---|
| Index of Refraction | 1.819 |
|---|
| InChIKey | MEBRHDOGOQBNLX-UHFFFAOYSA-N |
|---|
| SMILES | NC12CC3CC(C1)CC(n1cncn1)(C3)C2 |
|---|
