Introduction：Basic information about CAS 14995-38-1|Benzenesulfonic acid,4-ethyl-, sodium salt (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenesulfonic acid,4-ethyl-, sodium salt (1:1) |
|---|
| CAS Number | 14995-38-1 | Molecular Weight | 208.21000 |
|---|
| Density | 1.284g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C8H9NaO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | sodium,4-ethylbenzenesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.284g/cm3 |
|---|
| Molecular Formula | C8H9NaO3S |
|---|
| Molecular Weight | 208.21000 |
|---|
| Exact Mass | 208.01700 |
|---|
| PSA | 65.58000 |
|---|
| LogP | 2.23390 |
|---|
| InChIKey | LLELGQVCQVOGMA-UHFFFAOYSA-M |
|---|
| SMILES | CCc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2904100000 |
|---|
Customs
| HS Code | 2904100000 |
|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| sodium 4-ethyl-benzenesulfonate |
| Sodium p-ethylbenzenesulphonate |
| 4-ethyl-benzenesulfonic acid,sodium salt |
| EINECS 239-080-9 |
| Sodium p-ethylbenzenesulfonate |
| 4-Aethyl-benzolsulfonsaeure,Natriumsalz |
| SodiuM 4-Ethylbenzenesulfonate |
| 4-Ethylbenzenesulfonic Acid Sodium Salt |
| p-Ethylbenzenesulfonic acid,sodium salt |
| ethylbenzene-4-sulphonic acid sodium salt |
