Introduction：Basic information about CAS 918411-46-8|2S-7-Aza-bicyclo[2.2.1]heptane-2,7-dicarboxylic acid 7-tert-butyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2S-7-Aza-bicyclo[2.2.1]heptane-2,7-dicarboxylic acid 7-tert-butyl ester |
|---|
| CAS Number | 918411-46-8 | Molecular Weight | 241.28400 |
|---|
| Density | 1.233g/cm3 | Boiling Point | 371.004ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.177ºC |
|---|
Names
| Name | (1S,2S,4R)-7-(tert-Butoxycarbonyl)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.233g/cm3 |
|---|
| Boiling Point | 371.004ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19NO4 |
|---|
| Molecular Weight | 241.28400 |
|---|
| Flash Point | 178.177ºC |
|---|
| Exact Mass | 241.13100 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 1.79690 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | XRDRXGVDCVQVPV-VGMNWLOBSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(C(=O)O)C2 |
|---|
Synonyms
| (1R,3S,4S)-7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-3-carboxylic acid |
