Introduction：Basic information about CAS 42050-23-7|Nafetolol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nafetolol |
|---|
| CAS Number | 42050-23-7 | Molecular Weight | 319.43800 |
|---|
| Density | 1.136g/cm3 | Boiling Point | 472.5ºC at 760 mmHg |
|---|
| Molecular Formula | C19H29NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 239.5ºC |
|---|
Names
| Name | Nafetolol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.136g/cm3 |
|---|
| Boiling Point | 472.5ºC at 760 mmHg |
|---|
| Molecular Formula | C19H29NO3 |
|---|
| Molecular Weight | 319.43800 |
|---|
| Flash Point | 239.5ºC |
|---|
| Exact Mass | 319.21500 |
|---|
| PSA | 61.72000 |
|---|
| LogP | 3.66570 |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | GEVXLKYQQIKELK-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)NCC(O)COc1ccc(O)c2c1C1CCC2CC1 |
|---|
Synonyms
| K 5407 |
| 1-(tert-Butylamino)-3-[(1,2,3,4-tetrahydro-8-hydroxy-1,4-ethanonaphthalen-5-yl)oxy]-2-propanol |
| 1-tert.-Butylamino-3-(8'-hydroxy-1',4'-ethano-1',2',3',4'-tetrahydronaphth-5'-yloxy)-2-propanol |
