Introduction：Basic information about CAS 126294-30-2|Sagandipine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sagandipine |
|---|
| CAS Number | 126294-30-2 | Molecular Weight | 482.54400 |
|---|
| Density | 1.223g/cm3 | Boiling Point | 567.5ºC at 760mmHg |
|---|
| Molecular Formula | C27H31FN2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-O-methyl 5-O-[[5-(piperidin-1-ylmethyl)furan-2-yl]methyl] 4-(2-fluorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.223g/cm3 |
|---|
| Boiling Point | 567.5ºC at 760mmHg |
|---|
| Molecular Formula | C27H31FN2O5 |
|---|
| Molecular Weight | 482.54400 |
|---|
| Exact Mass | 482.22200 |
|---|
| PSA | 81.01000 |
|---|
| LogP | 4.82250 |
|---|
| Vapour Pressure | 6.79E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.56 |
|---|
| InChIKey | BFLVNSZFGLVPLU-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCc2ccc(CN3CCCCC3)o2)C1c1ccccc1F |
|---|
Synonyms
| Sagandipine |
| Sagandipine [INN] |
| UNII-20O65J0B72 |
| Methyl (5-piperidinomethyl)furfuryl 4-(o-fluorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate |
