Introduction：Basic information about CAS 57781-15-4|halopredone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | halopredone |
|---|
| CAS Number | 57781-15-4 | Molecular Weight | 475.32100 |
|---|
| Density | 1.59g/cm3 | Boiling Point | 611.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H25BrF2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 323.8ºC |
|---|
Names
| Name | halopredone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Boiling Point | 611.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H25BrF2O5 |
|---|
| Molecular Weight | 475.32100 |
|---|
| Flash Point | 323.8ºC |
|---|
| Exact Mass | 474.08500 |
|---|
| PSA | 94.83000 |
|---|
| LogP | 2.32030 |
|---|
| Index of Refraction | 1.609 |
|---|
| InChIKey | MYZDPUZXMFCPMU-LRIWMWCYSA-N |
|---|
| SMILES | CC12C=C(Br)C(=O)C=C1C(F)CC1C3CCC(O)(C(=O)CO)C3(C)CC(O)C12F |
|---|
Synonyms
| Phenol,2-bromo-6-ethenyl |
| 2-Bromo-6-vinyl-phenol |
