Introduction:Basic information about CAS 1926-48-3|Fenbenicillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fenbenicillin |
|---|
| CAS Number | 1926-48-3 | Molecular Weight | 426.48500 |
|---|
| Density | 1.41g/cm3 | Boiling Point | 736.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H22N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 399.1ºC |
|---|
Names
| Name | Fenbenicillin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.41g/cm3 |
|---|
| Boiling Point | 736.3ºC at 760mmHg |
|---|
| Molecular Formula | C22H22N2O5S |
|---|
| Molecular Weight | 426.48500 |
|---|
| Flash Point | 399.1ºC |
|---|
| Exact Mass | 426.12500 |
|---|
| PSA | 121.24000 |
|---|
| LogP | 2.76720 |
|---|
| Vapour Pressure | 9.22E-23mmHg at 25°C |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | VZPPEUOYDWPUKO-MQWDNKACSA-N |
|---|
| SMILES | CC1(C)SC2C(NC(=O)C(Oc3ccccc3)c3ccccc3)C(=O)N2C1C(=O)O |
|---|
Synonyms
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[2-(phenoxy)-2-phenylacetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| phenbenicillin |
| (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[[2-(phenoxy)-2-phenyl-ethanoyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| (2S,5R,6R)-7-keto-3,3-dimethyl-6-[[2-(phenoxy)-2-phenyl-acetyl]amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |