Introduction:Basic information about CAS 53966-34-0|Floxacrine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Floxacrine |
|---|
| CAS Number | 53966-34-0 | Molecular Weight | 407.77000 |
|---|
| Density | 1.56g/cm3 | Boiling Point | 545.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H13ClF3NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.6ºC |
|---|
Names
| Name | Floxacrine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.56g/cm3 |
|---|
| Boiling Point | 545.3ºC at 760mmHg |
|---|
| Molecular Formula | C20H13ClF3NO3 |
|---|
| Molecular Weight | 407.77000 |
|---|
| Flash Point | 283.6ºC |
|---|
| Exact Mass | 407.05400 |
|---|
| PSA | 59.30000 |
|---|
| LogP | 4.82370 |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | AWHZKKVSUJJVNL-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CC(c2ccc(C(F)(F)F)cc2)Cc2c1c(=O)c1cc(Cl)ccc1n2O |
|---|
Synonyms
| 7-chloro-10-hydroxy-3-(4-trifluoromethyl-phenyl)-3,4-dihydro-2H,10H-acridine-1,9-dione |
| 7-Chloro-3,4-dihydro-10-hydroxy-3-[p-(trifluoromethyl)phenyl]-1,9(2H,10H)-acridinedione |
| HOE-991 |
| 10H)-acridinedione |
| 3-(4-trifluoromethylphenyl)-7-chloro-10-hydroxy-3,4-dihydroacridine-1,9(2H,10H)-dione |
| 7-chloro-3,4-dihydro-10-hydroxy-3-<4-(trifluoromethyl)phenyl>-1,9(2H,10H)-acridinedione |
| 7-chloro-3,4-dihydro-10-hydroxy-3-<4-(trifluoromethyl)phenyl>-1,9(2H |