Introduction：Basic information about CAS 114517-02-1|Fosquidone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fosquidone |
|---|
| CAS Number | 114517-02-1 | Molecular Weight | 499.45100 |
|---|
| Density | 1.45g/cm3 | Boiling Point | 729.4ºC at 760mmHg |
|---|
| Molecular Formula | C28H22NO6P | Melting Point | / |
|---|
| MSDS | / | Flash Point | 394.9ºC |
|---|
Names
| Name | Fosquidone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45g/cm3 |
|---|
| Boiling Point | 729.4ºC at 760mmHg |
|---|
| Molecular Formula | C28H22NO6P |
|---|
| Molecular Weight | 499.45100 |
|---|
| Flash Point | 394.9ºC |
|---|
| Exact Mass | 499.11800 |
|---|
| PSA | 104.64000 |
|---|
| LogP | 5.47300 |
|---|
| Vapour Pressure | 2.47E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.7 |
|---|
| InChIKey | UXTSQCOOUJTIAC-UHFFFAOYSA-N |
|---|
| SMILES | CC1c2ccccc2Cn2cc3c(c21)C(=O)c1cccc(OP(=O)(O)OCc2ccccc2)c1C3=O |
|---|
Synonyms
| Phenylmethyl,[5,8,13,14-tetrahydro-14-methyl-8,13-dioxobenz[5,6]isoindolo[2,1-b]isoquinolin-9-yl]phosphoric acid |
| 1-Oxa-5-azaspiro[2.3]hexane-5-carboxylic acid phenylmethyl ester |
| phenylmethyl 1-oxa-5-azaspiro[2.3]hexane-5-carboxylate |
