Introduction:Basic information about CAS 124953-60-2|5-Isoxazolecarbonyl chloride, 3-phenyl- (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Isoxazolecarbonyl chloride, 3-phenyl- (9CI) |
|---|
| CAS Number | 124953-60-2 | Molecular Weight | 207.61300 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 370.2ºC at 760mmHg |
|---|
| Molecular Formula | C10H6ClNO2 | Melting Point | 90.5-91.5ºC |
|---|
| MSDS | / | Flash Point | 177.7ºC |
|---|
Names
| Name | 3-phenyl-1,2-oxazole-5-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 370.2ºC at 760mmHg |
|---|
| Melting Point | 90.5-91.5ºC |
|---|
| Molecular Formula | C10H6ClNO2 |
|---|
| Molecular Weight | 207.61300 |
|---|
| Flash Point | 177.7ºC |
|---|
| Exact Mass | 207.00900 |
|---|
| PSA | 43.10000 |
|---|
| LogP | 2.72060 |
|---|
| Vapour Pressure | 1.12E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | HGXKTMWKFBNMMH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(-c2ccccc2)no1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
Synonyms
| 5-Isoxazolecarbonylchloride,3-phenyl |
| 3-phenylisoxazole-5-carboxylic acid chloride |
| 3-phenyl-5-isoxazole carbonyl chloride |
| 3-Phenylisoxazole-5-carbonyl chloride |
| 5-(Chlorocarbonyl)-3-phenylisoxazole |