Introduction:Basic information about CAS 75001-09-1|2-[2-(2-Phthalimidoethoxy)ethoxy]acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[2-(2-Phthalimidoethoxy)ethoxy]acetic acid |
|---|
| CAS Number | 75001-09-1 | Molecular Weight | 293.272 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 504.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H15NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.7±25.9 °C |
|---|
Names
| Name | 2-[2-(2-Phthalimidoethoxy)ethoxy]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 504.1±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H15NO6 |
|---|
| Molecular Weight | 293.272 |
|---|
| Flash Point | 258.7±25.9 °C |
|---|
| Exact Mass | 293.089935 |
|---|
| PSA | 93.14000 |
|---|
| LogP | 0.63 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | AGGILFWPOHHPKV-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)COCCOCCN1C(=O)c2ccccc2C1=O |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-[2-[2-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]ethoxy]acetic acid |
| Acetic acid, 2-[2-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]ethoxy]- |
| Acetic acid,2-[2-[2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethoxy]ethoxy] |
| 3,6-Dioxa-8-phthalimidooctanoic acid |
| 2-(2-(2-(1,3-dioxoisoindolin-2-yl)ethoxy)ethoxy)acetic acid |
| 8-phthalimido-3,6-dioxaoctanoic acid |
| <2-(2-phthalimidoethoxy)ethoxy>acetic acid |
| 2-[2-(2-phtalimidoethoxy)ethoxy]acetic acid |
| {2-[2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)ethoxy]ethoxy}acetic acid |