Introduction:Basic information about CAS 68347-91-1|(6-PHENYLIMIDAZO[2,1-B][1,3]THIAZOL-3-YL)ACETIC ACID, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (6-PHENYLIMIDAZO[2,1-B][1,3]THIAZOL-3-YL)ACETIC ACID |
|---|
| CAS Number | 68347-91-1 | Molecular Weight | 258.29600 |
|---|
| Density | 1.42g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C13H10N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.42g/cm3 |
|---|
| Molecular Formula | C13H10N2O2S |
|---|
| Molecular Weight | 258.29600 |
|---|
| Exact Mass | 258.04600 |
|---|
| PSA | 82.84000 |
|---|
| LogP | 2.68990 |
|---|
| Index of Refraction | 1.718 |
|---|
| InChIKey | ZBDXJNSQBIUHPE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1csc2nc(-c3ccccc3)cn12 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| (6-phenyl-imidazo[2,1-b]thiazol-3-yl)-acetic acid |
| BB_SC-6296 |
| (6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid |
| 2-(6-phenylimidazo[2,1-b]thiazol-3-yl)acetic acid |
| 6-phenylimidazo<2,1-b>thiazole-3-acetic acid |
| 6-Phenyl-imidazo<2.1-b>thiazol-3-essigsaeure |