Introduction：Basic information about CAS 119645-65-7|Z-Ala-Trp-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Ala-Trp-OH |
|---|
| CAS Number | 119645-65-7 | Molecular Weight | 409.43500 |
|---|
| Density | 1.329g/cm3 | Boiling Point | 742.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H23N3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 402.7ºC |
|---|
Names
| Name | (2S)-3-(1H-indol-3-yl)-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.329g/cm3 |
|---|
| Boiling Point | 742.3ºC at 760 mmHg |
|---|
| Molecular Formula | C22H23N3O5 |
|---|
| Molecular Weight | 409.43500 |
|---|
| Flash Point | 402.7ºC |
|---|
| Exact Mass | 409.16400 |
|---|
| PSA | 120.52000 |
|---|
| LogP | 3.37650 |
|---|
| Vapour Pressure | 3.88E-23mmHg at 25°C |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | OEANOUHCLXZBNG-LIRRHRJNSA-N |
|---|
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
|---|
Synonyms
| HMS2211E14 |
| Cbz-L-Ala-L-Trp |
| Z-Ala-Trp-OH |
