Introduction:Basic information about CAS 53262-00-3|Z-Leu-Trp-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Leu-Trp-OH |
|---|
| CAS Number | 53262-00-3 | Molecular Weight | 451.51500 |
|---|
| Density | 1.261g/cm3 | Boiling Point | 744.8ºC at 760mmHg |
|---|
| Molecular Formula | C25H29N3O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 404.2ºC |
|---|
Names
| Name | 3-(1H-indol-3-yl)-2-[[4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]propanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.261g/cm3 |
|---|
| Boiling Point | 744.8ºC at 760mmHg |
|---|
| Molecular Formula | C25H29N3O5 |
|---|
| Molecular Weight | 451.51500 |
|---|
| Flash Point | 404.2ºC |
|---|
| Exact Mass | 451.21100 |
|---|
| PSA | 120.52000 |
|---|
| LogP | 4.40270 |
|---|
| Index of Refraction | 1.613 |
|---|
| InChIKey | OCRUSZPWPXFIFZ-VXKWHMMOSA-N |
|---|
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
|---|