CAS 216144-94-4|1H,1H-Perfluoro-1-hexadecanol
Introduction：Basic information about CAS 216144-94-4|1H,1H-Perfluoro-1-hexadecanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H,1H-Perfluoro-1-hexadecanol | ||
|---|---|---|---|
| CAS Number | 216144-94-4 | Molecular Weight | 800.145 |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 289.9±40.0 °C at 760 mmHg |
| Molecular Formula | C16H3F31O | Melting Point | 159-161ºC |
| MSDS | / | Flash Point | 129.1±27.3 °C |
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontafluorohexadecan-1-ol |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.9±40.0 °C at 760 mmHg |
| Melting Point | 159-161ºC |
| Molecular Formula | C16H3F31O |
| Molecular Weight | 800.145 |
| Flash Point | 129.1±27.3 °C |
| Exact Mass | 799.968872 |
| PSA | 20.23000 |
| LogP | 12.62 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.286 |
| InChIKey | KOOXQXFAIXTUHZ-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
Synonyms
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-Hentriacontafluorohexadecan-1-ol |
| 1-Hexadecanol, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontafluoro- |
| 1H,1H-Perfluoro-1-hexadecanol |
| 1h,1h-perfluorohexadecan-1-ol |
| PC6069 |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-Hentriacontafluoro-1-hexadecanol |
