Introduction：Basic information about CAS 67905-19-5|perfluorohexadecanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluorohexadecanoic acid |
|---|
| CAS Number | 67905-19-5 | Molecular Weight | 814.12800 |
|---|
| Density | 1.781 g/cm3 | Boiling Point | 211 °C |
|---|
| Molecular Formula | C16HF31O2 | Melting Point | 154 °C |
|---|
| MSDS | / | Flash Point | 211°C/100mm |
|---|
Names
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontafluorohexadecanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.781 g/cm3 |
|---|
| Boiling Point | 211 °C |
|---|
| Melting Point | 154 °C |
|---|
| Molecular Formula | C16HF31O2 |
|---|
| Molecular Weight | 814.12800 |
|---|
| Flash Point | 211°C/100mm |
|---|
| Exact Mass | 813.94800 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 9.52750 |
|---|
| Index of Refraction | 1.288 |
|---|
| InChIKey | OJMBMWRMTMHMSZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3261 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 8 |
|---|
Synonyms
| Hentriacontafluor-hexadecansaeure |
| MFCD00153239 |
| Perfluorohexadecanoic acid |
| Perfluoropalmitic acid |
| Hexadecanoic acid,hentriacontafluoro |
| EINECS 267-638-1 |
| hentriacontafluorohexadecanoic acid |
