Introduction:Basic information about CAS 2641-34-1|2,5-bis(trifluoromethyl)-3,6-dioxaundecafluorononanoyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-bis(trifluoromethyl)-3,6-dioxaundecafluorononanoyl fluoride |
|---|
| CAS Number | 2641-34-1 | Molecular Weight | 498.06600 |
|---|
| Density | 1.8 g/cm3 | Boiling Point | 113-115°C |
|---|
| Molecular Formula | C9F18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 71.1ºC |
|---|
Names
| Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propanoyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8 g/cm3 |
|---|
| Boiling Point | 113-115°C |
|---|
| Molecular Formula | C9F18O3 |
|---|
| Molecular Weight | 498.06600 |
|---|
| Flash Point | 71.1ºC |
|---|
| Exact Mass | 497.95600 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 5.35510 |
|---|
| Vapour Pressure | 0.392mmHg at 25°C |
|---|
| Index of Refraction | 1.279 |
|---|
| InChIKey | YSIGVPOSKQLNTO-UHFFFAOYSA-N |
|---|
| SMILES | O=C(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | 3265 |
|---|
| Hazard Class | 8.0 |
|---|
Synonyms
| Methylboronic acid pinacol ester |
| perfluoro-3,6-dioxa-2,5-dimethylnonanoyl fluoride |
| 2,4,4,5,5,-pentamethyl-1,3,2-dioxaborolane |
| EINECS 220-141-3 |
| pinacol methylboronate |
| 2-Ethyl-4,4,5,5-tetramethyl-1,3-dioxolane |
| MFCD00054658 |
| 2,5-BIS(TRIFLUOROMETHYL)-3,6-DIOXAUNDECAFLUORONONANOYL FLUORIDE |
| methylboronic acid pinacolate ester |