Introduction：Basic information about CAS 355-37-3|1H-Tridecafluorohexane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Tridecafluorohexane |
|---|
| CAS Number | 355-37-3 | Molecular Weight | 320.05100 |
|---|
| Density | 1,6843 g/cm3 | Boiling Point | 71°C |
|---|
| Molecular Formula | C6HF13 | Melting Point | -93ºC |
|---|
| MSDS | / | Flash Point | >110 |
|---|
Names
| Name | 1h-perfluorohexane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,6843 g/cm3 |
|---|
| Boiling Point | 71°C |
|---|
| Melting Point | -93ºC |
|---|
| Molecular Formula | C6HF13 |
|---|
| Molecular Weight | 320.05100 |
|---|
| Flash Point | >110 |
|---|
| Exact Mass | 319.98700 |
|---|
| LogP | 4.35500 |
|---|
| Index of Refraction | 1.3 |
|---|
| InChIKey | XJSRKJAHJGCPGC-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2903399090 |
|---|
Customs
| HS Code | 2903399090 |
|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| MFCD00142632 |
| 1H-Tridecafluorohexane |
| 1-Hydrotridecafluorohexane |
| 1H-Tridecafluoro-n-hexane |
| 1-H-perfluoroheptane |
| trideca-1,1,1,2,2,3,3,4,4,5,5,6,6-fluorohexane |
| TRIDECAFLUOROHEXANE |
| Perfluorohexyl-1-hydride |
| EINECS 206-581-9 |
| hydroperfluorohexane |
